C17H15ClFN3O3 — CID 13078230
ethyl (2Z)-2-amino-2-[[4-chloro-2-(2-fluorobenzoyl)phenyl]hydrazinylidene]acetate (PubChem CID 13078230) has the molecular formula C17H15ClFN3O3 and a molecular weight of 363.78 g/mol. Its IUPAC name is ethyl (2Z)-2-amino-2-[[4-chloro-2-(2-fluorobenzoyl)phenyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-amino-2-[[4-chloro-2-(2-fluorobenzoyl)phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 13078230 |
| Molecular Formula | C17H15ClFN3O3 |
| Molecular Weight | 363.78 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | ethyl (2Z)-2-amino-2-[[4-chloro-2-(2-fluorobenzoyl)phenyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N/Nc1ccc(Cl)cc1C(=O)c1ccccc1F |
| InChI | InChI=1S/C17H15ClFN3O3/c1-2-25-17(24)16(20)22-21-14-8-7-10(18)9-12(14)15(23)11-5-3-4-6-13(11)19/h3-9,21H,2H2,1H3,(H2,20,22) |
| InChIKey | SMYLSKYGWDLJKD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|