C16H14Cl2N4O2 — CID 13078236
(2Z)-2-amino-2-[[4-chloro-2-(2-chlorobenzoyl)phenyl]hydrazinylidene]-N-methylacetamide (PubChem CID 13078236) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is (2Z)-2-amino-2-[[4-chloro-2-(2-chlorobenzoyl)phenyl]hydrazinylidene]-N-methylacetamide.
| Compound Name | (2Z)-2-amino-2-[[4-chloro-2-(2-chlorobenzoyl)phenyl]hydrazinylidene]-N-methylacetamide |
|---|---|
| PubChem CID | 13078236 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (2Z)-2-amino-2-[[4-chloro-2-(2-chlorobenzoyl)phenyl]hydrazinylidene]-N-methylacetamide |
| SMILES | CNC(=O)/C(N)=N/Nc1ccc(Cl)cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-20-16(24)15(19)22-21-13-7-6-9(17)8-11(13)14(23)10-4-2-3-5-12(10)18/h2-8,21H,1H3,(H2,19,22)(H,20,24) |
| InChIKey | RKGLMRVMRVMNRV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|