C17H14ClFN4O5 — CID 135543738
ethyl 2-[[(E)-N-(5-chloro-2-nitroanilino)-C-(2-fluorophenyl)carbonimidoyl]amino]-2-oxoacetate (PubChem CID 135543738) has the molecular formula C17H14ClFN4O5 and a molecular weight of 408.77 g/mol. Its IUPAC name is ethyl 2-[[(E)-N-(5-chloro-2-nitroanilino)-C-(2-fluorophenyl)carbonimidoyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[(E)-N-(5-chloro-2-nitroanilino)-C-(2-fluorophenyl)carbonimidoyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 135543738 |
| Molecular Formula | C17H14ClFN4O5 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl 2-[[(E)-N-(5-chloro-2-nitroanilino)-C-(2-fluorophenyl)carbonimidoyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N/C(=N/Nc1cc(Cl)ccc1[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C17H14ClFN4O5/c1-2-28-17(25)16(24)20-15(11-5-3-4-6-12(11)19)22-21-13-9-10(18)7-8-14(13)23(26)27/h3-9,21H,2H2,1H3,(H,20,22,24) |
| InChIKey | LPKDHWJEBOSRQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|