C18H19ClN4O4 — CID 44614518
ethyl (1Z)-3-[(4-chlorophenyl)methylamino]-N-(2-nitrophenyl)-3-oxopropanehydrazonate (PubChem CID 44614518) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is ethyl (1Z)-3-[(4-chlorophenyl)methylamino]-N-(2-nitrophenyl)-3-oxopropanehydrazonate.
| Compound Name | ethyl (1Z)-3-[(4-chlorophenyl)methylamino]-N-(2-nitrophenyl)-3-oxopropanehydrazonate |
|---|---|
| PubChem CID | 44614518 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | ethyl (1Z)-3-[(4-chlorophenyl)methylamino]-N-(2-nitrophenyl)-3-oxopropanehydrazonate |
| SMILES | CCO/C(CC(=O)NCc1ccc(Cl)cc1)=N\Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19ClN4O4/c1-2-27-18(22-21-15-5-3-4-6-16(15)23(25)26)11-17(24)20-12-13-7-9-14(19)10-8-13/h3-10,21H,2,11-12H2,1H3,(H,20,24)/b22-18- |
| InChIKey | GLMCWUICATWEKL-PYCFMQQDSA-N |
| XLogP | 3.72 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|