C15H21N3O4 — CID 129431843
ethyl (2R)-2-[C-methyl-N-(2-nitroanilino)carbonimidoyl]pentanoate (PubChem CID 129431843) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl (2R)-2-[C-methyl-N-(2-nitroanilino)carbonimidoyl]pentanoate.
| Compound Name | ethyl (2R)-2-[C-methyl-N-(2-nitroanilino)carbonimidoyl]pentanoate |
|---|---|
| PubChem CID | 129431843 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl (2R)-2-[C-methyl-N-(2-nitroanilino)carbonimidoyl]pentanoate |
| SMILES | CCC[C@@H](C(=O)OCC)C(C)=NNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O4/c1-4-8-12(15(19)22-5-2)11(3)16-17-13-9-6-7-10-14(13)18(20)21/h6-7,9-10,12,17H,4-5,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | WTHDKHSPTSJGRN-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|