C26H24Cl2N2O4 — CID 87640977
ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate (PubChem CID 87640977) has the molecular formula C26H24Cl2N2O4 and a molecular weight of 499.39 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 87640977 |
| Molecular Formula | C26H24Cl2N2O4 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
| SMILES | CCOC(=O)C(=O)C(C)C(=NNc1ccc(Cl)cc1Cl)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O4/c1-3-33-26(32)25(31)17(2)24(30-29-23-14-11-20(27)15-22(23)28)19-9-12-21(13-10-19)34-16-18-7-5-4-6-8-18/h4-15,17,29H,3,16H2,1-2H3 |
| InChIKey | JUDDVCOFTWZROU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|