About ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate
ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate (PubChem CID 87640977) has the molecular formula C26H24Cl2N2O4
and a molecular weight of 499.39 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
| PubChem CID | 87640977 |
| Molecular Formula | C26H24Cl2N2O4 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
| SMILES | CCOC(=O)C(=O)C(C)C(=NNc1ccc(Cl)cc1Cl)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O4/c1-3-33-26(32)25(31)17(2)24(30-29-23-14-11-20(27)15-22(23)28)19-9-12-21(13-10-19)34-16-18-7-5-4-6-8-18/h4-15,17,29H,3,16H2,1-2H3 |
| InChIKey | JUDDVCOFTWZROU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate?
The IUPAC name of ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate (CID 87640977) is ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate.
What is the SMILES notation for ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate?
The canonical SMILES for ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate is CCOC(=O)C(=O)C(C)C(=NNc1ccc(Cl)cc1Cl)c1ccc(OCc2ccccc2)cc1.
What is the InChIKey of ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate?
The InChIKey is JUDDVCOFTWZROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24Cl2N2O4/c1-3-33-26(32)25(31)17(2)24(30-29-23-14-11-20(27)15-22(23)28)19-9-12-21(13-10-19)34-16-18-7-5-4-6-8-18/h4-15,17,29H,3,16H2,1-2H3.
What are the key properties of ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate?
ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate has a molecular weight of 499.39 g/mol, XLogP of 6.16, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate is sourced from PubChem (CID 87640977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).