C18H25ClN2O2 — CID 177442913
ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-3,7-dimethyloct-6-enoate (PubChem CID 177442913) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-3,7-dimethyloct-6-enoate.
| Compound Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 177442913 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-3,7-dimethyloct-6-enoate |
| SMILES | CCOC(=O)/C(=N\Nc1ccc(Cl)cc1)C(C)CCC=C(C)C |
| InChI | InChI=1S/C18H25ClN2O2/c1-5-23-18(22)17(14(4)8-6-7-13(2)3)21-20-16-11-9-15(19)10-12-16/h7,9-12,14,20H,5-6,8H2,1-4H3/b21-17- |
| InChIKey | VNGKEQSYPDQRNI-FXBPSFAMSA-N |
| XLogP | 5.05 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|