ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate

C19H22N4O2 — CID 71428518

IUPACethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate
SMILESCCOC(=O)C(C=NNc1ccc(C)cc1)=NNc1ccc(C)cc1
InChIInChI=1S/C19H22N4O2/c1-4-25-19(24)18(23-22-17-11-7-15(3)8-12-17)13-20-21-16-9-5-14(2)6-10-16/h5-13,21-22H,4H2,1-3H3
InChIKeySJUZNJPKSAQJDY-UHFFFAOYSA-N
MW338.41 g/mol
LogP3.73
Rot. Bonds7

About ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate

ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate (PubChem CID 71428518) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate.

Molecular Properties

Compound Nameethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate
PubChem CID71428518
Molecular FormulaC19H22N4O2
Molecular Weight338.41 g/mol
Exact Mass338.17
IUPAC Nameethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate
SMILESCCOC(=O)C(C=NNc1ccc(C)cc1)=NNc1ccc(C)cc1
InChIInChI=1S/C19H22N4O2/c1-4-25-19(24)18(23-22-17-11-7-15(3)8-12-17)13-20-21-16-9-5-14(2)6-10-16/h5-13,21-22H,4H2,1-3H3
InChIKeySJUZNJPKSAQJDY-UHFFFAOYSA-N
XLogP3.73
TPSA75.08 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.41
LogP ≤ 53.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate?
The IUPAC name of ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate (CID 71428518) is ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate.
What is the SMILES notation for ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate?
The canonical SMILES for ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate is CCOC(=O)C(C=NNc1ccc(C)cc1)=NNc1ccc(C)cc1.
What is the InChIKey of ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate?
The InChIKey is SJUZNJPKSAQJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-4-25-19(24)18(23-22-17-11-7-15(3)8-12-17)13-20-21-16-9-5-14(2)6-10-16/h5-13,21-22H,4H2,1-3H3.
What are the key properties of ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate?
ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate has a molecular weight of 338.41 g/mol, XLogP of 3.73, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate is sourced from PubChem (CID 71428518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).