C19H22N4O2 — CID 71428518
ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate (PubChem CID 71428518) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 71428518 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | ethyl 2,3-bis[(4-methylphenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)C(C=NNc1ccc(C)cc1)=NNc1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-4-25-19(24)18(23-22-17-11-7-15(3)8-12-17)13-20-21-16-9-5-14(2)6-10-16/h5-13,21-22H,4H2,1-3H3 |
| InChIKey | SJUZNJPKSAQJDY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|