C11H15N3O — CID 177401018
(2E)-N,N-dimethyl-2-[(4-methylphenyl)hydrazinylidene]acetamide (PubChem CID 177401018) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-2-[(4-methylphenyl)hydrazinylidene]acetamide.
| Compound Name | (2E)-N,N-dimethyl-2-[(4-methylphenyl)hydrazinylidene]acetamide |
|---|---|
| PubChem CID | 177401018 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (2E)-N,N-dimethyl-2-[(4-methylphenyl)hydrazinylidene]acetamide |
| SMILES | Cc1ccc(N/N=C/C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C11H15N3O/c1-9-4-6-10(7-5-9)13-12-8-11(15)14(2)3/h4-8,13H,1-3H3/b12-8+ |
| InChIKey | QSWYLXHJFHUGCB-XYOKQWHBSA-N |
| XLogP | 1.48 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|