C21H22N4O2S — CID 7661905
ethyl (2E)-2-[2-(4-methylanilino)-1,3-thiazol-4-yl]-2-[(4-methylphenyl)hydrazinylidene]acetate (PubChem CID 7661905) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is ethyl (2E)-2-[2-(4-methylanilino)-1,3-thiazol-4-yl]-2-[(4-methylphenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-[2-(4-methylanilino)-1,3-thiazol-4-yl]-2-[(4-methylphenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 7661905 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | ethyl (2E)-2-[2-(4-methylanilino)-1,3-thiazol-4-yl]-2-[(4-methylphenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(C)cc1)c1csc(Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C21H22N4O2S/c1-4-27-20(26)19(25-24-17-11-7-15(3)8-12-17)18-13-28-21(23-18)22-16-9-5-14(2)6-10-16/h5-13,24H,4H2,1-3H3,(H,22,23)/b25-19+ |
| InChIKey | ZJWNEUZMTPQIAJ-NCELDCMTSA-N |
| XLogP | 4.88 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|