C10H12N2O5S — CID 176888579
4-[2-(2-ethoxy-2-oxoethylidene)hydrazinyl]benzenesulfonic acid (PubChem CID 176888579) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 4-[2-(2-ethoxy-2-oxoethylidene)hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[2-(2-ethoxy-2-oxoethylidene)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 176888579 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-[2-(2-ethoxy-2-oxoethylidene)hydrazinyl]benzenesulfonic acid |
| SMILES | CCOC(=O)C=NNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O5S/c1-2-17-10(13)7-11-12-8-3-5-9(6-4-8)18(14,15)16/h3-7,12H,2H2,1H3,(H,14,15,16) |
| InChIKey | PPOLHHKOGFJDBZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|