C14H14N2NaO4S+ — CID 126465894
sodium 4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]benzenesulfonic acid (PubChem CID 126465894) has the molecular formula C14H14N2NaO4S+ and a molecular weight of 329.33 g/mol. Its IUPAC name is sodium 4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]benzenesulfonic acid.
| Compound Name | sodium 4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 126465894 |
| Molecular Formula | C14H14N2NaO4S+ |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | sodium 4-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]benzenesulfonic acid |
| SMILES | COc1cccc(/C=N/Nc2ccc(S(=O)(=O)O)cc2)c1.[Na+] |
| InChI | InChI=1S/C14H14N2O4S.Na/c1-20-13-4-2-3-11(9-13)10-15-16-12-5-7-14(8-6-12)21(17,18)19;/h2-10,16H,1H3,(H,17,18,19);/q;+1/b15-10+; |
| InChIKey | WZINFWOLEPWTPC-GYVLLFFHSA-N |
| XLogP | -0.61 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|