C14H16N2O8S2 — CID 88689314
3-methoxybenzaldehyde;4-(2-sulfohydrazinyl)benzenesulfonic acid (PubChem CID 88689314) has the molecular formula C14H16N2O8S2 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-methoxybenzaldehyde;4-(2-sulfohydrazinyl)benzenesulfonic acid.
| Compound Name | 3-methoxybenzaldehyde;4-(2-sulfohydrazinyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88689314 |
| Molecular Formula | C14H16N2O8S2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 3-methoxybenzaldehyde;4-(2-sulfohydrazinyl)benzenesulfonic acid |
| SMILES | COc1cccc(C=O)c1.O=S(=O)(O)NNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H8O2.C6H8N2O6S2/c1-10-8-4-2-3-7(5-8)6-9;9-15(10,11)6-3-1-5(2-4-6)7-8-16(12,13)14/h2-6H,1H3;1-4,7-8H,(H,9,10,11)(H,12,13,14) |
| InChIKey | CMGRCOTYILTOPE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|