About anilinosulfamic acid;4-methylbenzaldehyde
anilinosulfamic acid;4-methylbenzaldehyde (PubChem CID 88688555) has the molecular formula C14H16N2O4S
and a molecular weight of 308.36 g/mol. Its IUPAC name is anilinosulfamic acid;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | anilinosulfamic acid;4-methylbenzaldehyde |
| PubChem CID | 88688555 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | anilinosulfamic acid;4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.O=S(=O)(O)NNc1ccccc1 |
| InChI | InChI=1S/C8H8O.C6H8N2O3S/c1-7-2-4-8(6-9)5-3-7;9-12(10,11)8-7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7-8H,(H,9,10,11) |
| InChIKey | RPBUXVNQECCVSI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze anilinosulfamic acid;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilinosulfamic acid;4-methylbenzaldehyde?
The IUPAC name of anilinosulfamic acid;4-methylbenzaldehyde (CID 88688555) is anilinosulfamic acid;4-methylbenzaldehyde.
What is the SMILES notation for anilinosulfamic acid;4-methylbenzaldehyde?
The canonical SMILES for anilinosulfamic acid;4-methylbenzaldehyde is Cc1ccc(C=O)cc1.O=S(=O)(O)NNc1ccccc1.
What is the InChIKey of anilinosulfamic acid;4-methylbenzaldehyde?
The InChIKey is RPBUXVNQECCVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H8N2O3S/c1-7-2-4-8(6-9)5-3-7;9-12(10,11)8-7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7-8H,(H,9,10,11).
What are the key properties of anilinosulfamic acid;4-methylbenzaldehyde?
anilinosulfamic acid;4-methylbenzaldehyde has a molecular weight of 308.36 g/mol, XLogP of 2.21, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anilinosulfamic acid;4-methylbenzaldehyde is sourced from PubChem (CID 88688555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).