About benzaldehyde;1,2-diphenylhydrazine
benzaldehyde;1,2-diphenylhydrazine (PubChem CID 159261806) has the molecular formula C19H18N2O
and a molecular weight of 290.37 g/mol. Its IUPAC name is benzaldehyde;1,2-diphenylhydrazine.
Molecular Properties
| Compound Name | benzaldehyde;1,2-diphenylhydrazine |
| PubChem CID | 159261806 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | benzaldehyde;1,2-diphenylhydrazine |
| SMILES | O=Cc1ccccc1.c1ccc(NNc2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2.C7H6O/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10,13-14H;1-6H |
| InChIKey | KWPJTZSADWMNAK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;1,2-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;1,2-diphenylhydrazine?
The IUPAC name of benzaldehyde;1,2-diphenylhydrazine (CID 159261806) is benzaldehyde;1,2-diphenylhydrazine.
What is the SMILES notation for benzaldehyde;1,2-diphenylhydrazine?
The canonical SMILES for benzaldehyde;1,2-diphenylhydrazine is O=Cc1ccccc1.c1ccc(NNc2ccccc2)cc1.
What is the InChIKey of benzaldehyde;1,2-diphenylhydrazine?
The InChIKey is KWPJTZSADWMNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C7H6O/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10,13-14H;1-6H.
What are the key properties of benzaldehyde;1,2-diphenylhydrazine?
benzaldehyde;1,2-diphenylhydrazine has a molecular weight of 290.37 g/mol, XLogP of 4.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;1,2-diphenylhydrazine is sourced from PubChem (CID 159261806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).