About 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline
4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline (PubChem CID 58987717) has the molecular formula C16H16Cl3N3
and a molecular weight of 356.68 g/mol. Its IUPAC name is 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline.
Molecular Properties
| Compound Name | 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline |
| PubChem CID | 58987717 |
| Molecular Formula | C16H16Cl3N3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline |
| SMILES | CC/C(=N\Nc1ccc(Cl)cc1Cl)c1cc(Cl)ccc1NC |
| InChI | InChI=1S/C16H16Cl3N3/c1-3-14(12-8-10(17)4-6-15(12)20-2)21-22-16-7-5-11(18)9-13(16)19/h4-9,20,22H,3H2,1-2H3/b21-14+ |
| InChIKey | DXTDZUMBGJEHHH-KGENOOAVSA-N |
| XLogP | 5.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline?
The IUPAC name of 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline (CID 58987717) is 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline.
What is the SMILES notation for 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline?
The canonical SMILES for 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline is CC/C(=N\Nc1ccc(Cl)cc1Cl)c1cc(Cl)ccc1NC.
What is the InChIKey of 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline?
The InChIKey is DXTDZUMBGJEHHH-KGENOOAVSA-N. The full InChI is InChI=1S/C16H16Cl3N3/c1-3-14(12-8-10(17)4-6-15(12)20-2)21-22-16-7-5-11(18)9-13(16)19/h4-9,20,22H,3H2,1-2H3/b21-14+.
What are the key properties of 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline?
4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline has a molecular weight of 356.68 g/mol, XLogP of 5.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(E)-N-(2,4-dichloroanilino)-C-ethylcarbonimidoyl]-N-methylaniline is sourced from PubChem (CID 58987717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).