C15H14Cl3N3 — CID 89326976
4-chloro-2-[(E)-N-(3,5-dichloroanilino)-C-ethylcarbonimidoyl]aniline (PubChem CID 89326976) has the molecular formula C15H14Cl3N3 and a molecular weight of 342.66 g/mol. Its IUPAC name is 4-chloro-2-[(E)-N-(3,5-dichloroanilino)-C-ethylcarbonimidoyl]aniline.
| Compound Name | 4-chloro-2-[(E)-N-(3,5-dichloroanilino)-C-ethylcarbonimidoyl]aniline |
|---|---|
| PubChem CID | 89326976 |
| Molecular Formula | C15H14Cl3N3 |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-chloro-2-[(E)-N-(3,5-dichloroanilino)-C-ethylcarbonimidoyl]aniline |
| SMILES | CC/C(=N\Nc1cc(Cl)cc(Cl)c1)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H14Cl3N3/c1-2-15(13-8-9(16)3-4-14(13)19)21-20-12-6-10(17)5-11(18)7-12/h3-8,20H,2,19H2,1H3/b21-15+ |
| InChIKey | NWCSQYWYIANMSH-RCCKNPSSSA-N |
| XLogP | 5.46 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|