C18H18Cl3N3O — CID 90837915
2,4-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]propylideneamino]-N-methylbenzamide (PubChem CID 90837915) has the molecular formula C18H18Cl3N3O and a molecular weight of 398.72 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]propylideneamino]-N-methylbenzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]propylideneamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 90837915 |
| Molecular Formula | C18H18Cl3N3O |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-1-[5-chloro-2-(methylamino)phenyl]propylideneamino]-N-methylbenzamide |
| SMILES | CC/C(=N/N(C)C(=O)c1ccc(Cl)cc1Cl)c1cc(Cl)ccc1NC |
| InChI | InChI=1S/C18H18Cl3N3O/c1-4-16(14-9-11(19)6-8-17(14)22-2)23-24(3)18(25)13-7-5-12(20)10-15(13)21/h5-10,22H,4H2,1-3H3/b23-16- |
| InChIKey | OCKCOOIRCRQNRB-KQWNVCNZSA-N |
| XLogP | 5.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|