C17H9Cl3F3N5 — CID 6415793
6-chloro-N-[(Z)-[(4-chlorophenyl)-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylidene]amino]pyridazin-3-amine (PubChem CID 6415793) has the molecular formula C17H9Cl3F3N5 and a molecular weight of 446.65 g/mol. Its IUPAC name is 6-chloro-N-[(Z)-[(4-chlorophenyl)-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylidene]amino]pyridazin-3-amine.
| Compound Name | 6-chloro-N-[(Z)-[(4-chlorophenyl)-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylidene]amino]pyridazin-3-amine |
|---|---|
| PubChem CID | 6415793 |
| Molecular Formula | C17H9Cl3F3N5 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | 6-chloro-N-[(Z)-[(4-chlorophenyl)-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylidene]amino]pyridazin-3-amine |
| SMILES | FC(F)(F)c1cnc(/C(=N\Nc2ccc(Cl)nn2)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl3F3N5/c18-11-3-1-9(2-4-11)15(28-27-14-6-5-13(20)25-26-14)16-12(19)7-10(8-24-16)17(21,22)23/h1-8H,(H,26,27)/b28-15- |
| InChIKey | FPCPWWYEHXWIIH-MBTHVWNTSA-N |
| XLogP | 5.72 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|