C13H7ClF5N3O2S — CID 125116865
3-chloro-N'-(2,6-difluorophenyl)sulfonyl-5-(trifluoromethyl)pyridine-2-carboximidamide (PubChem CID 125116865) has the molecular formula C13H7ClF5N3O2S and a molecular weight of 399.73 g/mol. Its IUPAC name is 3-chloro-N'-(2,6-difluorophenyl)sulfonyl-5-(trifluoromethyl)pyridine-2-carboximidamide.
| Compound Name | 3-chloro-N'-(2,6-difluorophenyl)sulfonyl-5-(trifluoromethyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 125116865 |
| Molecular Formula | C13H7ClF5N3O2S |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 3-chloro-N'-(2,6-difluorophenyl)sulfonyl-5-(trifluoromethyl)pyridine-2-carboximidamide |
| SMILES | NC(=NS(=O)(=O)c1c(F)cccc1F)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H7ClF5N3O2S/c14-7-4-6(13(17,18)19)5-21-10(7)12(20)22-25(23,24)11-8(15)2-1-3-9(11)16/h1-5H,(H2,20,22) |
| InChIKey | NDIZUKLOTNAQQX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|