C13H7Cl3F3N3O — CID 2781467
1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-(2,4-dichlorophenyl)urea (PubChem CID 2781467) has the molecular formula C13H7Cl3F3N3O and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 2781467 |
| Molecular Formula | C13H7Cl3F3N3O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(Cl)n1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl3F3N3O/c14-7-1-2-9(8(15)5-7)20-12(23)22-11-4-6(13(17,18)19)3-10(16)21-11/h1-5H,(H2,20,21,22,23) |
| InChIKey | DTWZOTDCNKCZHF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|