C14H9Cl4N3O2 — CID 2781768
2,6-dichloro-N-[(2,4-dichlorophenyl)carbamoyl]-4-methylpyridine-3-carboxamide (PubChem CID 2781768) has the molecular formula C14H9Cl4N3O2 and a molecular weight of 393.06 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2,4-dichlorophenyl)carbamoyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[(2,4-dichlorophenyl)carbamoyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 2781768 |
| Molecular Formula | C14H9Cl4N3O2 |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | 2,6-dichloro-N-[(2,4-dichlorophenyl)carbamoyl]-4-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(Cl)c1C(=O)NC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl4N3O2/c1-6-4-10(17)20-12(18)11(6)13(22)21-14(23)19-9-3-2-7(15)5-8(9)16/h2-5H,1H3,(H2,19,21,22,23) |
| InChIKey | JNSQLNCLKPAQRY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|