C13H14Cl2N2O4 — CID 65300019
4-[(2,4-dichlorophenyl)carbamoylamino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65300019) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)carbamoylamino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[(2,4-dichlorophenyl)carbamoylamino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65300019 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)carbamoylamino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)NC(=O)Nc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-13(2,11(19)20)6-10(18)17-12(21)16-9-4-3-7(14)5-8(9)15/h3-5H,6H2,1-2H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | MFQIFQOQLKOCBZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |