C12H11ClN6OS — CID 70677465
1-[(3-aminopyrazine-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea (PubChem CID 70677465) has the molecular formula C12H11ClN6OS and a molecular weight of 322.78 g/mol. Its IUPAC name is 1-[(3-aminopyrazine-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[(3-aminopyrazine-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 70677465 |
| Molecular Formula | C12H11ClN6OS |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[(3-aminopyrazine-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea |
| SMILES | Nc1nccnc1C(=O)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN6OS/c13-7-1-3-8(4-2-7)17-12(21)19-18-11(20)9-10(14)16-6-5-15-9/h1-6H,(H2,14,16)(H,18,20)(H2,17,19,21) |
| InChIKey | AOKUNLACHRZLRR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|