C17H11Cl2N3O3S — CID 9317388
1-[(6-chloro-4-oxochromene-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea (PubChem CID 9317388) has the molecular formula C17H11Cl2N3O3S and a molecular weight of 408.27 g/mol. Its IUPAC name is 1-[(6-chloro-4-oxochromene-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[(6-chloro-4-oxochromene-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 9317388 |
| Molecular Formula | C17H11Cl2N3O3S |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 1-[(6-chloro-4-oxochromene-2-carbonyl)amino]-3-(4-chlorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Cl)cc1)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H11Cl2N3O3S/c18-9-1-4-11(5-2-9)20-17(26)22-21-16(24)15-8-13(23)12-7-10(19)3-6-14(12)25-15/h1-8H,(H,21,24)(H2,20,22,26) |
| InChIKey | KOFFCBLKMWLAIJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|