C18H13ClFNO5 — CID 99585387
6-chloro-N-(5-fluoro-2,4-dimethoxyphenyl)-4-oxochromene-2-carboxamide (PubChem CID 99585387) has the molecular formula C18H13ClFNO5 and a molecular weight of 377.76 g/mol. Its IUPAC name is 6-chloro-N-(5-fluoro-2,4-dimethoxyphenyl)-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-N-(5-fluoro-2,4-dimethoxyphenyl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 99585387 |
| Molecular Formula | C18H13ClFNO5 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 6-chloro-N-(5-fluoro-2,4-dimethoxyphenyl)-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cc(=O)c3cc(Cl)ccc3o2)cc1F |
| InChI | InChI=1S/C18H13ClFNO5/c1-24-15-8-16(25-2)12(6-11(15)20)21-18(23)17-7-13(22)10-5-9(19)3-4-14(10)26-17/h3-8H,1-2H3,(H,21,23) |
| InChIKey | YRDISRCXGWKJEA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |