C14H13ClN2O4 — CID 9481083
6-chloro-N-[2-(dimethylamino)-2-oxoethyl]-4-oxochromene-2-carboxamide (PubChem CID 9481083) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 6-chloro-N-[2-(dimethylamino)-2-oxoethyl]-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(dimethylamino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 9481083 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-chloro-N-[2-(dimethylamino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
| SMILES | CN(C)C(=O)CNC(=O)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-17(2)13(19)7-16-14(20)12-6-10(18)9-5-8(15)3-4-11(9)21-12/h3-6H,7H2,1-2H3,(H,16,20) |
| InChIKey | CKEKCXXWDBXQKR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |