C23H24ClN2O3+ — CID 8546439
6-chloro-4-oxo-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]chromene-2-carboxamide (PubChem CID 8546439) has the molecular formula C23H24ClN2O3+ and a molecular weight of 411.91 g/mol. Its IUPAC name is 6-chloro-4-oxo-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]chromene-2-carboxamide.
| Compound Name | 6-chloro-4-oxo-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 8546439 |
| Molecular Formula | C23H24ClN2O3+ |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 6-chloro-4-oxo-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]chromene-2-carboxamide |
| SMILES | O=C(NCc1ccc(C[NH+]2CCCCC2)cc1)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C23H23ClN2O3/c24-18-8-9-21-19(12-18)20(27)13-22(29-21)23(28)25-14-16-4-6-17(7-5-16)15-26-10-2-1-3-11-26/h4-9,12-13H,1-3,10-11,14-15H2,(H,25,28)/p+1 |
| InChIKey | GFCOMZDKFJHXCS-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |