C18H17ClN2O4 — CID 26834060
6-chloro-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-oxochromene-2-carboxamide (PubChem CID 26834060) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 6-chloro-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 26834060 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 6-chloro-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-oxochromene-2-carboxamide |
| SMILES | CN(C)[C@H](CNC(=O)c1cc(=O)c2cc(Cl)ccc2o1)c1ccco1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-21(2)13(16-4-3-7-24-16)10-20-18(23)17-9-14(22)12-8-11(19)5-6-15(12)25-17/h3-9,13H,10H2,1-2H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | BGWCVRKIUCQMIP-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |