C20H19ClN3O3+ — CID 9226731
6-chloro-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]chromen-4-one (PubChem CID 9226731) has the molecular formula C20H19ClN3O3+ and a molecular weight of 384.84 g/mol. Its IUPAC name is 6-chloro-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]chromen-4-one.
| Compound Name | 6-chloro-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 9226731 |
| Molecular Formula | C20H19ClN3O3+ |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 6-chloro-2-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-15-1-2-18-16(11-15)17(25)12-19(27-18)20(26)24-9-7-23(8-10-24)13-14-3-5-22-6-4-14/h1-6,11-12H,7-10,13H2/p+1 |
| InChIKey | SFIYDTITRGZLBB-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |