C19H18ClN3O3 — CID 90495108
6-chloro-2-[4-(pyrazol-1-ylmethyl)piperidine-1-carbonyl]chromen-4-one (PubChem CID 90495108) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 6-chloro-2-[4-(pyrazol-1-ylmethyl)piperidine-1-carbonyl]chromen-4-one.
| Compound Name | 6-chloro-2-[4-(pyrazol-1-ylmethyl)piperidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 90495108 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 6-chloro-2-[4-(pyrazol-1-ylmethyl)piperidine-1-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C19H18ClN3O3/c20-14-2-3-17-15(10-14)16(24)11-18(26-17)19(25)22-8-4-13(5-9-22)12-23-7-1-6-21-23/h1-3,6-7,10-11,13H,4-5,8-9,12H2 |
| InChIKey | UUMYOKAKVUKTIT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |