C22H24ClN3O3 — CID 90493337
7-chloro-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carbonyl]-6-methylchromen-4-one (PubChem CID 90493337) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 7-chloro-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carbonyl]-6-methylchromen-4-one.
| Compound Name | 7-chloro-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carbonyl]-6-methylchromen-4-one |
|---|---|
| PubChem CID | 90493337 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 7-chloro-2-[4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carbonyl]-6-methylchromen-4-one |
| SMILES | CCc1nccn1CC1CCN(C(=O)c2cc(=O)c3cc(C)c(Cl)cc3o2)CC1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-3-21-24-6-9-26(21)13-15-4-7-25(8-5-15)22(28)20-12-18(27)16-10-14(2)17(23)11-19(16)29-20/h6,9-12,15H,3-5,7-8,13H2,1-2H3 |
| InChIKey | WZESYLAUGOBXML-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |