C15H16ClN3O5S — CID 166246994
1-(6-chloro-4-oxochromene-2-carbonyl)-4-(sulfamoylamino)piperidine (PubChem CID 166246994) has the molecular formula C15H16ClN3O5S and a molecular weight of 385.83 g/mol. Its IUPAC name is 1-(6-chloro-4-oxochromene-2-carbonyl)-4-(sulfamoylamino)piperidine.
| Compound Name | 1-(6-chloro-4-oxochromene-2-carbonyl)-4-(sulfamoylamino)piperidine |
|---|---|
| PubChem CID | 166246994 |
| Molecular Formula | C15H16ClN3O5S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-(6-chloro-4-oxochromene-2-carbonyl)-4-(sulfamoylamino)piperidine |
| SMILES | NS(=O)(=O)NC1CCN(C(=O)c2cc(=O)c3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C15H16ClN3O5S/c16-9-1-2-13-11(7-9)12(20)8-14(24-13)15(21)19-5-3-10(4-6-19)18-25(17,22)23/h1-2,7-8,10,18H,3-6H2,(H2,17,22,23) |
| InChIKey | KSQXEYAFNQKZNL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |