C14H18N4O4S — CID 167911199
5-methyl-2-[4-(sulfamoylamino)piperidine-1-carbonyl]furo[3,2-b]pyridine (PubChem CID 167911199) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-methyl-2-[4-(sulfamoylamino)piperidine-1-carbonyl]furo[3,2-b]pyridine.
| Compound Name | 5-methyl-2-[4-(sulfamoylamino)piperidine-1-carbonyl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 167911199 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 5-methyl-2-[4-(sulfamoylamino)piperidine-1-carbonyl]furo[3,2-b]pyridine |
| SMILES | Cc1ccc2oc(C(=O)N3CCC(NS(N)(=O)=O)CC3)cc2n1 |
| InChI | InChI=1S/C14H18N4O4S/c1-9-2-3-12-11(16-9)8-13(22-12)14(19)18-6-4-10(5-7-18)17-23(15,20)21/h2-3,8,10,17H,4-7H2,1H3,(H2,15,20,21) |
| InChIKey | JNXVACFENIHTFP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |