C17H14ClNO4 — CID 7751403
N-(5-chloro-2,4-dimethoxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 7751403) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7751403 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cc3ccccc3o2)cc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c1-21-14-9-15(22-2)12(8-11(14)18)19-17(20)16-7-10-5-3-4-6-13(10)23-16/h3-9H,1-2H3,(H,19,20) |
| InChIKey | KMGNBNARIVYNSV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |