C15H11ClN4OS — CID 9469110
1-(4-chlorophenyl)-3-[(4-cyanobenzoyl)amino]thiourea (PubChem CID 9469110) has the molecular formula C15H11ClN4OS and a molecular weight of 330.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4-cyanobenzoyl)amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4-cyanobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9469110 |
| Molecular Formula | C15H11ClN4OS |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4-cyanobenzoyl)amino]thiourea |
| SMILES | N#Cc1ccc(C(=O)NNC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H11ClN4OS/c16-12-5-7-13(8-6-12)18-15(22)20-19-14(21)11-3-1-10(9-17)2-4-11/h1-8H,(H,19,21)(H2,18,20,22) |
| InChIKey | KQGRQNNEADHZFU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|