C17H24N4O3S — CID 143658232
2-(1-aminoethylidenecarbamothioyl)-N'-hydroxy-N-phenyloctanediamide (PubChem CID 143658232) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(1-aminoethylidenecarbamothioyl)-N'-hydroxy-N-phenyloctanediamide.
| Compound Name | 2-(1-aminoethylidenecarbamothioyl)-N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 143658232 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(1-aminoethylidenecarbamothioyl)-N'-hydroxy-N-phenyloctanediamide |
| SMILES | C/C(N)=N\C(=S)C(CCCCCC(=O)NO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H24N4O3S/c1-12(18)19-17(25)14(10-6-3-7-11-15(22)21-24)16(23)20-13-8-4-2-5-9-13/h2,4-5,8-9,14,24H,3,6-7,10-11H2,1H3,(H,20,23)(H,21,22)(H2,18,19,25) |
| InChIKey | KUKQAILYOOLGGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|