C23H30N2O5 — CID 25066354
N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylnonanediamide (PubChem CID 25066354) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylnonanediamide.
| Compound Name | N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylnonanediamide |
|---|---|
| PubChem CID | 25066354 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N'-hydroxy-2-[(4-methoxyphenyl)methoxy]-N-phenylnonanediamide |
| SMILES | COc1ccc(COC(CCCCCCC(=O)NO)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-29-20-15-13-18(14-16-20)17-30-21(11-7-2-3-8-12-22(26)25-28)23(27)24-19-9-5-4-6-10-19/h4-6,9-10,13-16,21,28H,2-3,7-8,11-12,17H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | OYQSMPNKPPIDON-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|