C17H24N2O4 — CID 174602137
N-hydroxy-2-(2-methylprop-2-enoxy)-N'-phenylheptanediamide (PubChem CID 174602137) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-hydroxy-2-(2-methylprop-2-enoxy)-N'-phenylheptanediamide.
| Compound Name | N-hydroxy-2-(2-methylprop-2-enoxy)-N'-phenylheptanediamide |
|---|---|
| PubChem CID | 174602137 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-hydroxy-2-(2-methylprop-2-enoxy)-N'-phenylheptanediamide |
| SMILES | C=C(C)COC(CCCCC(=O)Nc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C17H24N2O4/c1-13(2)12-23-15(17(21)19-22)10-6-7-11-16(20)18-14-8-4-3-5-9-14/h3-5,8-9,15,22H,1,6-7,10-12H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | HTSPUGJVYSVHLI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|