C11H13Br2NO — CID 174352057
5,5-dibromo-N-phenylpentanamide (PubChem CID 174352057) has the molecular formula C11H13Br2NO and a molecular weight of 335.04 g/mol. Its IUPAC name is 5,5-dibromo-N-phenylpentanamide.
| Compound Name | 5,5-dibromo-N-phenylpentanamide |
|---|---|
| PubChem CID | 174352057 |
| Molecular Formula | C11H13Br2NO |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 5,5-dibromo-N-phenylpentanamide |
| SMILES | O=C(CCCC(Br)Br)Nc1ccccc1 |
| InChI | InChI=1S/C11H13Br2NO/c12-10(13)7-4-8-11(15)14-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,14,15) |
| InChIKey | VNBQRPSTDVFSMW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|