C30H33N3O3S — CID 69323102
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]thiophene-2-carboxamide (PubChem CID 69323102) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 69323102 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1cccs1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C30H33N3O3S/c1-21(34)11-4-2-7-16-26(33-30(36)27-17-10-20-37-27)29(35)31-19-18-24-23-14-8-9-15-25(23)32-28(24)22-12-5-3-6-13-22/h3,5-6,8-10,12-15,17,20,26,32H,2,4,7,11,16,18-19H2,1H3,(H,31,35)(H,33,36)/t26-/m0/s1 |
| InChIKey | SMWBTNMZEXCYMC-SANMLTNESA-N |
| XLogP | 5.89 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|