C35H38N4O4 — CID 69323418
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 69323418) has the molecular formula C35H38N4O4 and a molecular weight of 578.71 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 69323418 |
| Molecular Formula | C35H38N4O4 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)N[C@@H](CCCCCC(C)=O)C(=O)NCCc3c(-c4ccccc4)[nH]c4ccccc34)cc2c1 |
| InChI | InChI=1S/C35H38N4O4/c1-23(40)11-5-3-8-16-31(39-35(42)32-22-25-21-26(43-2)17-18-29(25)37-32)34(41)36-20-19-28-27-14-9-10-15-30(27)38-33(28)24-12-6-4-7-13-24/h4,6-7,9-10,12-15,17-18,21-22,31,37-38H,3,5,8,11,16,19-20H2,1-2H3,(H,36,41)(H,39,42)/t31-/m0/s1 |
| InChIKey | PUABWPYVWFIONE-HKBQPEDESA-N |
| XLogP | 6.32 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|