C29H36N4O3 — CID 140528434
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]azetidine-2-carboxamide (PubChem CID 140528434) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]azetidine-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 140528434 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]azetidine-2-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CCN1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C29H36N4O3/c1-20(34)10-4-2-7-15-26(33-29(36)25-17-19-30-25)28(35)31-18-16-23-22-13-8-9-14-24(22)32-27(23)21-11-5-3-6-12-21/h3,5-6,8-9,11-14,25-26,30,32H,2,4,7,10,15-19H2,1H3,(H,31,35)(H,33,36)/t25?,26-/m0/s1 |
| InChIKey | OXEUAJAKZKYSDU-AMVUTOCUSA-N |
| XLogP | 3.88 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|