C37H44N4O3 — CID 69327864
N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-6-phenylpiperidine-2-carboxamide (PubChem CID 69327864) has the molecular formula C37H44N4O3 and a molecular weight of 592.78 g/mol. Its IUPAC name is N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-6-phenylpiperidine-2-carboxamide.
| Compound Name | N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-6-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 69327864 |
| Molecular Formula | C37H44N4O3 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-6-phenylpiperidine-2-carboxamide |
| SMILES | CC(=O)CCCCCC(NC(=O)C1CCCC(c2ccccc2)N1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C37H44N4O3/c1-26(42)14-5-2-10-21-33(41-37(44)34-23-13-22-31(39-34)27-15-6-3-7-16-27)36(43)38-25-24-30-29-19-11-12-20-32(29)40-35(30)28-17-8-4-9-18-28/h3-4,6-9,11-12,15-20,31,33-34,39-40H,2,5,10,13-14,21-25H2,1H3,(H,38,43)(H,41,44) |
| InChIKey | DSNLWUUREDRKFS-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|