C31H33N3O5 — CID 69320738
(2S)-2-[[2-(furan-2-yl)-2-oxoacetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide (PubChem CID 69320738) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is (2S)-2-[[2-(furan-2-yl)-2-oxoacetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide.
| Compound Name | (2S)-2-[[2-(furan-2-yl)-2-oxoacetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 69320738 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (2S)-2-[[2-(furan-2-yl)-2-oxoacetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C(=O)c1ccco1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C31H33N3O5/c1-21(35)11-4-2-7-16-26(34-31(38)29(36)27-17-10-20-39-27)30(37)32-19-18-24-23-14-8-9-15-25(23)33-28(24)22-12-5-3-6-13-22/h3,5-6,8-10,12-15,17,20,26,33H,2,4,7,11,16,18-19H2,1H3,(H,32,37)(H,34,38)/t26-/m0/s1 |
| InChIKey | SJQDNNKNBFLVRC-SANMLTNESA-N |
| XLogP | 4.99 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|