C32H36N4O3S — CID 69321858
(2S)-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2-[(2-pyridin-4-ylsulfanylacetyl)amino]nonanamide (PubChem CID 69321858) has the molecular formula C32H36N4O3S and a molecular weight of 556.73 g/mol. Its IUPAC name is (2S)-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2-[(2-pyridin-4-ylsulfanylacetyl)amino]nonanamide.
| Compound Name | (2S)-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2-[(2-pyridin-4-ylsulfanylacetyl)amino]nonanamide |
|---|---|
| PubChem CID | 69321858 |
| Molecular Formula | C32H36N4O3S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (2S)-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2-[(2-pyridin-4-ylsulfanylacetyl)amino]nonanamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)CSc1ccncc1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C32H36N4O3S/c1-23(37)10-4-2-7-15-29(35-30(38)22-40-25-16-19-33-20-17-25)32(39)34-21-18-27-26-13-8-9-14-28(26)36-31(27)24-11-5-3-6-12-24/h3,5-6,8-9,11-14,16-17,19-20,29,36H,2,4,7,10,15,18,21-22H2,1H3,(H,34,39)(H,35,38)/t29-/m0/s1 |
| InChIKey | WQZQGTJQPHEDHF-LJAQVGFWSA-N |
| XLogP | 5.71 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|