C35H36N4O3 — CID 69319567
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]quinoline-5-carboxamide (PubChem CID 69319567) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]quinoline-5-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 69319567 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]quinoline-5-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1cccc2ncccc12)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C35H36N4O3/c1-24(40)12-4-2-7-19-32(39-34(41)29-16-10-20-30-27(29)17-11-22-36-30)35(42)37-23-21-28-26-15-8-9-18-31(26)38-33(28)25-13-5-3-6-14-25/h3,5-6,8-11,13-18,20,22,32,38H,2,4,7,12,19,21,23H2,1H3,(H,37,42)(H,39,41)/t32-/m0/s1 |
| InChIKey | MYMOEZMOTFFNRO-YTTGMZPUSA-N |
| XLogP | 6.38 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|