C31H33BrN4O3 — CID 69321024
5-bromo-N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]pyridine-3-carboxamide (PubChem CID 69321024) has the molecular formula C31H33BrN4O3 and a molecular weight of 589.53 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69321024 |
| Molecular Formula | C31H33BrN4O3 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 5-bromo-N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)c1cncc(Br)c1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C31H33BrN4O3/c1-21(37)10-4-2-7-15-28(36-30(38)23-18-24(32)20-33-19-23)31(39)34-17-16-26-25-13-8-9-14-27(25)35-29(26)22-11-5-3-6-12-22/h3,5-6,8-9,11-14,18-20,28,35H,2,4,7,10,15-17H2,1H3,(H,34,39)(H,36,38)/t28-/m0/s1 |
| InChIKey | JEGLSHGIRPUWCG-NDEPHWFRSA-N |
| XLogP | 5.99 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|