C36H38N4O4 — CID 69328273
N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 69328273) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 69328273 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | N-[1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(=O)CCCCCC(NC(=O)c1c(-c2ccccc2)noc1C)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C36H38N4O4/c1-24(41)14-6-3-11-21-31(39-36(43)32-25(2)44-40-34(32)27-17-9-5-10-18-27)35(42)37-23-22-29-28-19-12-13-20-30(28)38-33(29)26-15-7-4-8-16-26/h4-5,7-10,12-13,15-20,31,38H,3,6,11,14,21-23H2,1-2H3,(H,37,42)(H,39,43) |
| InChIKey | RAQOSZMXHFXWAH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|