C33H36ClN3O3 — CID 69321419
(2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide (PubChem CID 69321419) has the molecular formula C33H36ClN3O3 and a molecular weight of 558.12 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide.
| Compound Name | (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 69321419 |
| Molecular Formula | C33H36ClN3O3 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenyl)acetyl]amino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C33H36ClN3O3/c1-23(38)10-4-2-7-15-30(36-31(39)22-24-16-18-26(34)19-17-24)33(40)35-21-20-28-27-13-8-9-14-29(27)37-32(28)25-11-5-3-6-12-25/h3,5-6,8-9,11-14,16-19,30,37H,2,4,7,10,15,20-22H2,1H3,(H,35,40)(H,36,39)/t30-/m0/s1 |
| InChIKey | VIDYKBJIXOKOMS-PMERELPUSA-N |
| XLogP | 6.41 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|